C24H28N2O7S — CID 47012023
(3-morpholin-4-ylsulfonylphenyl)methyl 3-[(4-oxo-4-phenylbutanoyl)amino]propanoate (PubChem CID 47012023) has the molecular formula C24H28N2O7S and a molecular weight of 488.56 g/mol. Its IUPAC name is (3-morpholin-4-ylsulfonylphenyl)methyl 3-[(4-oxo-4-phenylbutanoyl)amino]propanoate.
| Compound Name | (3-morpholin-4-ylsulfonylphenyl)methyl 3-[(4-oxo-4-phenylbutanoyl)amino]propanoate |
|---|---|
| PubChem CID | 47012023 |
| Molecular Formula | C24H28N2O7S |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | (3-morpholin-4-ylsulfonylphenyl)methyl 3-[(4-oxo-4-phenylbutanoyl)amino]propanoate |
| SMILES | O=C(CCC(=O)c1ccccc1)NCCC(=O)OCc1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C24H28N2O7S/c27-22(20-6-2-1-3-7-20)9-10-23(28)25-12-11-24(29)33-18-19-5-4-8-21(17-19)34(30,31)26-13-15-32-16-14-26/h1-8,17H,9-16,18H2,(H,25,28) |
| InChIKey | SNWOAEJVUMXTDZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |