C20H22N2O6S — CID 7783364
(3-morpholin-4-ylsulfonylphenyl)methyl 2-benzamidoacetate (PubChem CID 7783364) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is (3-morpholin-4-ylsulfonylphenyl)methyl 2-benzamidoacetate.
| Compound Name | (3-morpholin-4-ylsulfonylphenyl)methyl 2-benzamidoacetate |
|---|---|
| PubChem CID | 7783364 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | (3-morpholin-4-ylsulfonylphenyl)methyl 2-benzamidoacetate |
| SMILES | O=C(CNC(=O)c1ccccc1)OCc1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H22N2O6S/c23-19(14-21-20(24)17-6-2-1-3-7-17)28-15-16-5-4-8-18(13-16)29(25,26)22-9-11-27-12-10-22/h1-8,13H,9-12,14-15H2,(H,21,24) |
| InChIKey | BHMUYBLHOROJPM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |