C20H20ClN3O8S — CID 5021735
[2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-chloro-5-nitrobenzoate (PubChem CID 5021735) has the molecular formula C20H20ClN3O8S and a molecular weight of 497.91 g/mol. Its IUPAC name is [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-chloro-5-nitrobenzoate.
| Compound Name | [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 5021735 |
| Molecular Formula | C20H20ClN3O8S |
| Molecular Weight | 497.91 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-chloro-5-nitrobenzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2cc([N+](=O)[O-])ccc2Cl)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H20ClN3O8S/c1-13-2-3-14(10-18(13)33(29,30)23-6-8-31-9-7-23)22-19(25)12-32-20(26)16-11-15(24(27)28)4-5-17(16)21/h2-5,10-11H,6-9,12H2,1H3,(H,22,25) |
| InChIKey | YATMZYLNSGIZHU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.91 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|