C21H26N4O6S — CID 51924820
2-[(E)-[amino-(2-methoxyphenyl)methylidene]amino]oxy-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 51924820) has the molecular formula C21H26N4O6S and a molecular weight of 462.53 g/mol. Its IUPAC name is 2-[(E)-[amino-(2-methoxyphenyl)methylidene]amino]oxy-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[(E)-[amino-(2-methoxyphenyl)methylidene]amino]oxy-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 51924820 |
| Molecular Formula | C21H26N4O6S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2-[(E)-[amino-(2-methoxyphenyl)methylidene]amino]oxy-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | COc1ccccc1/C(N)=N\OCC(=O)Nc1ccc(C)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C21H26N4O6S/c1-15-7-8-16(13-19(15)32(27,28)25-9-11-30-12-10-25)23-20(26)14-31-24-21(22)17-5-3-4-6-18(17)29-2/h3-8,13H,9-12,14H2,1-2H3,(H2,22,24)(H,23,26) |
| InChIKey | SEASIZVSWWYJRV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|