C19H23N5O6S — CID 136693013
2-[[amino-(2-oxo-1H-pyridin-3-yl)methylidene]amino]oxy-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 136693013) has the molecular formula C19H23N5O6S and a molecular weight of 449.49 g/mol. Its IUPAC name is 2-[[amino-(2-oxo-1H-pyridin-3-yl)methylidene]amino]oxy-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[[amino-(2-oxo-1H-pyridin-3-yl)methylidene]amino]oxy-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 136693013 |
| Molecular Formula | C19H23N5O6S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 2-[[amino-(2-oxo-1H-pyridin-3-yl)methylidene]amino]oxy-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CON=C(N)c2ccc[nH]c2=O)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H23N5O6S/c1-13-4-5-14(11-16(13)31(27,28)24-7-9-29-10-8-24)22-17(25)12-30-23-18(20)15-3-2-6-21-19(15)26/h2-6,11H,7-10,12H2,1H3,(H2,20,23)(H,21,26)(H,22,25) |
| InChIKey | GXNVGMSOYYRJRH-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 156.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|