C22H19NO7S — CID 46788299
[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 4-oxochromene-2-carboxylate (PubChem CID 46788299) has the molecular formula C22H19NO7S and a molecular weight of 441.46 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 4-oxochromene-2-carboxylate.
| Compound Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 46788299 |
| Molecular Formula | C22H19NO7S |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 4-oxochromene-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc(=O)c2ccccc2o1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C22H19NO7S/c24-18-13-21(30-20-6-2-1-5-17(18)20)22(26)29-14-19(25)15-7-9-16(10-8-15)31(27,28)23-11-3-4-12-23/h1-2,5-10,13H,3-4,11-12,14H2 |
| InChIKey | BLCLXRVTWMXYOC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 110.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |