C18H19NO5 — CID 2433745
[2-(azepan-1-yl)-2-oxoethyl] 4-oxochromene-2-carboxylate (PubChem CID 2433745) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is [2-(azepan-1-yl)-2-oxoethyl] 4-oxochromene-2-carboxylate.
| Compound Name | [2-(azepan-1-yl)-2-oxoethyl] 4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 2433745 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | [2-(azepan-1-yl)-2-oxoethyl] 4-oxochromene-2-carboxylate |
| SMILES | O=C(OCC(=O)N1CCCCCC1)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C18H19NO5/c20-14-11-16(24-15-8-4-3-7-13(14)15)18(22)23-12-17(21)19-9-5-1-2-6-10-19/h3-4,7-8,11H,1-2,5-6,9-10,12H2 |
| InChIKey | PAUKXKCZIRMTJU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |