C23H22N2O7S — CID 55397085
[2-(4-benzylsulfonylpiperazin-1-yl)-2-oxoethyl] 4-oxochromene-2-carboxylate (PubChem CID 55397085) has the molecular formula C23H22N2O7S and a molecular weight of 470.50 g/mol. Its IUPAC name is [2-(4-benzylsulfonylpiperazin-1-yl)-2-oxoethyl] 4-oxochromene-2-carboxylate.
| Compound Name | [2-(4-benzylsulfonylpiperazin-1-yl)-2-oxoethyl] 4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 55397085 |
| Molecular Formula | C23H22N2O7S |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | [2-(4-benzylsulfonylpiperazin-1-yl)-2-oxoethyl] 4-oxochromene-2-carboxylate |
| SMILES | O=C(OCC(=O)N1CCN(S(=O)(=O)Cc2ccccc2)CC1)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C23H22N2O7S/c26-19-14-21(32-20-9-5-4-8-18(19)20)23(28)31-15-22(27)24-10-12-25(13-11-24)33(29,30)16-17-6-2-1-3-7-17/h1-9,14H,10-13,15-16H2 |
| InChIKey | ILDLLGZALKQWOI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |