C24H26N2O6S — CID 41402895
7-[2-(4-benzylsulfonylpiperazin-1-yl)-2-oxoethoxy]-4-ethylchromen-2-one (PubChem CID 41402895) has the molecular formula C24H26N2O6S and a molecular weight of 470.55 g/mol. Its IUPAC name is 7-[2-(4-benzylsulfonylpiperazin-1-yl)-2-oxoethoxy]-4-ethylchromen-2-one.
| Compound Name | 7-[2-(4-benzylsulfonylpiperazin-1-yl)-2-oxoethoxy]-4-ethylchromen-2-one |
|---|---|
| PubChem CID | 41402895 |
| Molecular Formula | C24H26N2O6S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 7-[2-(4-benzylsulfonylpiperazin-1-yl)-2-oxoethoxy]-4-ethylchromen-2-one |
| SMILES | CCc1cc(=O)oc2cc(OCC(=O)N3CCN(S(=O)(=O)Cc4ccccc4)CC3)ccc12 |
| InChI | InChI=1S/C24H26N2O6S/c1-2-19-14-24(28)32-22-15-20(8-9-21(19)22)31-16-23(27)25-10-12-26(13-11-25)33(29,30)17-18-6-4-3-5-7-18/h3-9,14-15H,2,10-13,16-17H2,1H3 |
| InChIKey | YUARECFCWCCVEB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|