C22H21ClN2O4 — CID 9020059
7-[2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethoxy]-4-methylchromen-2-one (PubChem CID 9020059) has the molecular formula C22H21ClN2O4 and a molecular weight of 412.87 g/mol. Its IUPAC name is 7-[2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethoxy]-4-methylchromen-2-one.
| Compound Name | 7-[2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 9020059 |
| Molecular Formula | C22H21ClN2O4 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 7-[2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethoxy]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)N3CCN(c4ccccc4Cl)CC3)ccc12 |
| InChI | InChI=1S/C22H21ClN2O4/c1-15-12-22(27)29-20-13-16(6-7-17(15)20)28-14-21(26)25-10-8-24(9-11-25)19-5-3-2-4-18(19)23/h2-7,12-13H,8-11,14H2,1H3 |
| InChIKey | ZVAKDTUOELIZTQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|