C23H28N2O6 — CID 172639776
tert-butyl 3-[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 172639776) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is tert-butyl 3-[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 172639776 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | tert-butyl 3-[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)N3CC4CCC(C3)N4C(=O)OC(C)(C)C)ccc12 |
| InChI | InChI=1S/C23H28N2O6/c1-14-9-21(27)30-19-10-17(7-8-18(14)19)29-13-20(26)24-11-15-5-6-16(12-24)25(15)22(28)31-23(2,3)4/h7-10,15-16H,5-6,11-13H2,1-4H3 |
| InChIKey | OMHQVOGPINVNDK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|