C24H25NO6 — CID 26817511
7-[2-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-2-oxoethoxy]-4-methylchromen-2-one (PubChem CID 26817511) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is 7-[2-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-2-oxoethoxy]-4-methylchromen-2-one.
| Compound Name | 7-[2-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-2-oxoethoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 26817511 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 7-[2-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-2-oxoethoxy]-4-methylchromen-2-one |
| SMILES | COc1ccc(OC)c([C@H]2CCCN2C(=O)COc2ccc3c(C)cc(=O)oc3c2)c1 |
| InChI | InChI=1S/C24H25NO6/c1-15-11-24(27)31-22-13-17(6-8-18(15)22)30-14-23(26)25-10-4-5-20(25)19-12-16(28-2)7-9-21(19)29-3/h6-9,11-13,20H,4-5,10,14H2,1-3H3/t20-/m1/s1 |
| InChIKey | YQOFBNHPZPBGAQ-HXUWFJFHSA-N |
| XLogP | 3.86 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|