C24H27NO4 — CID 8833523
4-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-6,7-dimethylchromen-2-one (PubChem CID 8833523) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 4-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 8833523 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 4-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-6,7-dimethylchromen-2-one |
| SMILES | COc1ccc(OC)c([C@@H]2CCCN2Cc2cc(=O)oc3cc(C)c(C)cc23)c1 |
| InChI | InChI=1S/C24H27NO4/c1-15-10-19-17(12-24(26)29-23(19)11-16(15)2)14-25-9-5-6-21(25)20-13-18(27-3)7-8-22(20)28-4/h7-8,10-13,21H,5-6,9,14H2,1-4H3/t21-/m0/s1 |
| InChIKey | ASCKQDCDZYVHKV-NRFANRHFSA-N |
| XLogP | 4.76 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|