C19H23NO4 — CID 34923696
methyl (2S)-1-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]piperidine-2-carboxylate (PubChem CID 34923696) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is methyl (2S)-1-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]piperidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 34923696 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | methyl (2S)-1-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]piperidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCCN1Cc1cc(=O)oc2cc(C)c(C)cc12 |
| InChI | InChI=1S/C19H23NO4/c1-12-8-15-14(10-18(21)24-17(15)9-13(12)2)11-20-7-5-4-6-16(20)19(22)23-3/h8-10,16H,4-7,11H2,1-3H3/t16-/m0/s1 |
| InChIKey | ZDTFYZTZJQXTPX-INIZCTEOSA-N |
| XLogP | 2.94 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|