C18H21NO6S — CID 27931573
(6,7-dimethyl-2-oxochromen-4-yl)methyl (2S)-1-methylsulfonylpyrrolidine-2-carboxylate (PubChem CID 27931573) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl (2S)-1-methylsulfonylpyrrolidine-2-carboxylate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl (2S)-1-methylsulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 27931573 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl (2S)-1-methylsulfonylpyrrolidine-2-carboxylate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)[C@@H]3CCCN3S(C)(=O)=O)c2cc1C |
| InChI | InChI=1S/C18H21NO6S/c1-11-7-14-13(9-17(20)25-16(14)8-12(11)2)10-24-18(21)15-5-4-6-19(15)26(3,22)23/h7-9,15H,4-6,10H2,1-3H3/t15-/m0/s1 |
| InChIKey | NLAGCTVRWSZJQO-HNNXBMFYSA-N |
| XLogP | 1.88 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|