C21H23NO5 — CID 71896872
(7,8-dimethyl-2-oxochromen-4-yl)methyl 1-(cyclopropanecarbonyl)pyrrolidine-2-carboxylate (PubChem CID 71896872) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 1-(cyclopropanecarbonyl)pyrrolidine-2-carboxylate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 1-(cyclopropanecarbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 71896872 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 1-(cyclopropanecarbonyl)pyrrolidine-2-carboxylate |
| SMILES | Cc1ccc2c(COC(=O)C3CCCN3C(=O)C3CC3)cc(=O)oc2c1C |
| InChI | InChI=1S/C21H23NO5/c1-12-5-8-16-15(10-18(23)27-19(16)13(12)2)11-26-21(25)17-4-3-9-22(17)20(24)14-6-7-14/h5,8,10,14,17H,3-4,6-7,9,11H2,1-2H3 |
| InChIKey | ODOHTPYWCQBKJP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|