C20H21NO5S — CID 2578490
(7,8-dimethyl-2-oxochromen-4-yl)methyl (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 2578490) has the molecular formula C20H21NO5S and a molecular weight of 387.46 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 2578490 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | Cc1ccc2c(COC(=O)[C@@H]3CS[C@@]4(C)CCC(=O)N34)cc(=O)oc2c1C |
| InChI | InChI=1S/C20H21NO5S/c1-11-4-5-14-13(8-17(23)26-18(14)12(11)2)9-25-19(24)15-10-27-20(3)7-6-16(22)21(15)20/h4-5,8,15H,6-7,9-10H2,1-3H3/t15-,20-/m0/s1 |
| InChIKey | MJRJAURTSRAMPJ-YWZLYKJASA-N |
| XLogP | 2.91 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|