C17H19NO5S — CID 7823022
(4-methoxycarbonylphenyl)methyl (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 7823022) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl)methyl (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | (4-methoxycarbonylphenyl)methyl (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7823022 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (4-methoxycarbonylphenyl)methyl (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)[C@@H]2CS[C@@]3(C)CCC(=O)N23)cc1 |
| InChI | InChI=1S/C17H19NO5S/c1-17-8-7-14(19)18(17)13(10-24-17)16(21)23-9-11-3-5-12(6-4-11)15(20)22-2/h3-6,13H,7-10H2,1-2H3/t13-,17-/m0/s1 |
| InChIKey | FFSFXGVJOIKFQZ-GUYCJALGSA-N |
| XLogP | 1.97 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |