C16H19NO3S2 — CID 7823496
(4-methylsulfanylphenyl)methyl (3S,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 7823496) has the molecular formula C16H19NO3S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is (4-methylsulfanylphenyl)methyl (3S,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | (4-methylsulfanylphenyl)methyl (3S,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7823496 |
| Molecular Formula | C16H19NO3S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | (4-methylsulfanylphenyl)methyl (3S,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | CSc1ccc(COC(=O)[C@H]2CS[C@@]3(C)CCC(=O)N23)cc1 |
| InChI | InChI=1S/C16H19NO3S2/c1-16-8-7-14(18)17(16)13(10-22-16)15(19)20-9-11-3-5-12(21-2)6-4-11/h3-6,13H,7-10H2,1-2H3/t13-,16+/m1/s1 |
| InChIKey | YXBNWKCWBKHFLI-CJNGLKHVSA-N |
| XLogP | 2.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |