C18H21ClN2O4S — CID 7822496
[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 7822496) has the molecular formula C18H21ClN2O4S and a molecular weight of 396.90 g/mol. Its IUPAC name is [2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7822496 |
| Molecular Formula | C18H21ClN2O4S |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | [2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | C[C@]12CCC(=O)N1[C@H](C(=O)OCC(=O)NCCc1ccc(Cl)cc1)CS2 |
| InChI | InChI=1S/C18H21ClN2O4S/c1-18-8-6-16(23)21(18)14(11-26-18)17(24)25-10-15(22)20-9-7-12-2-4-13(19)5-3-12/h2-5,14H,6-11H2,1H3,(H,20,22)/t14-,18-/m0/s1 |
| InChIKey | HNLRBYNURTVXMF-KSSFIOAISA-N |
| XLogP | 2.00 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |