C16H17ClN2O4S — CID 7823259
[2-(3-chloroanilino)-2-oxoethyl] (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 7823259) has the molecular formula C16H17ClN2O4S and a molecular weight of 368.84 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7823259 |
| Molecular Formula | C16H17ClN2O4S |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | C[C@]12CCC(=O)N1[C@H](C(=O)OCC(=O)Nc1cccc(Cl)c1)CS2 |
| InChI | InChI=1S/C16H17ClN2O4S/c1-16-6-5-14(21)19(16)12(9-24-16)15(22)23-8-13(20)18-11-4-2-3-10(17)7-11/h2-4,7,12H,5-6,8-9H2,1H3,(H,18,20)/t12-,16-/m0/s1 |
| InChIKey | GNYMNVUQPSVLNS-LRDDRELGSA-N |
| XLogP | 2.28 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |