C16H16ClN3O6S — CID 7823487
[2-(4-chloro-3-nitroanilino)-2-oxoethyl] (3S,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 7823487) has the molecular formula C16H16ClN3O6S and a molecular weight of 413.84 g/mol. Its IUPAC name is [2-(4-chloro-3-nitroanilino)-2-oxoethyl] (3S,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [2-(4-chloro-3-nitroanilino)-2-oxoethyl] (3S,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7823487 |
| Molecular Formula | C16H16ClN3O6S |
| Molecular Weight | 413.84 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | [2-(4-chloro-3-nitroanilino)-2-oxoethyl] (3S,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | C[C@@]12CCC(=O)N1[C@@H](C(=O)OCC(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1)CS2 |
| InChI | InChI=1S/C16H16ClN3O6S/c1-16-5-4-14(22)19(16)12(8-27-16)15(23)26-7-13(21)18-9-2-3-10(17)11(6-9)20(24)25/h2-3,6,12H,4-5,7-8H2,1H3,(H,18,21)/t12-,16-/m1/s1 |
| InChIKey | CYVTWBFWWOOEKF-MLGOLLRUSA-N |
| XLogP | 2.18 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.84 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|