C18H22ClN3O6S2 — CID 40786629
[2-[2-chloro-5-(dimethylsulfamoyl)anilino]-2-oxoethyl] (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 40786629) has the molecular formula C18H22ClN3O6S2 and a molecular weight of 475.98 g/mol. Its IUPAC name is [2-[2-chloro-5-(dimethylsulfamoyl)anilino]-2-oxoethyl] (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [2-[2-chloro-5-(dimethylsulfamoyl)anilino]-2-oxoethyl] (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 40786629 |
| Molecular Formula | C18H22ClN3O6S2 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | [2-[2-chloro-5-(dimethylsulfamoyl)anilino]-2-oxoethyl] (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | CN(C)S(=O)(=O)c1ccc(Cl)c(NC(=O)COC(=O)[C@@H]2CS[C@]3(C)CCC(=O)N23)c1 |
| InChI | InChI=1S/C18H22ClN3O6S2/c1-18-7-6-16(24)22(18)14(10-29-18)17(25)28-9-15(23)20-13-8-11(4-5-12(13)19)30(26,27)21(2)3/h4-5,8,14H,6-7,9-10H2,1-3H3,(H,20,23)/t14-,18+/m0/s1 |
| InChIKey | BOSQPBFTYGFYOJ-KBXCAEBGSA-N |
| XLogP | 1.53 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |