C22H29N3O6S2 — CID 40943501
[2-(2-methyl-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 40943501) has the molecular formula C22H29N3O6S2 and a molecular weight of 495.62 g/mol. Its IUPAC name is [2-(2-methyl-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [2-(2-methyl-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 40943501 |
| Molecular Formula | C22H29N3O6S2 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | [2-(2-methyl-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)COC(=O)[C@@H]1CS[C@]2(C)CCC(=O)N12 |
| InChI | InChI=1S/C22H29N3O6S2/c1-15-6-7-16(33(29,30)24-10-4-3-5-11-24)12-17(15)23-19(26)13-31-21(28)18-14-32-22(2)9-8-20(27)25(18)22/h6-7,12,18H,3-5,8-11,13-14H2,1-2H3,(H,23,26)/t18-,22+/m0/s1 |
| InChIKey | XIDXUUOWHNOMQK-PGRDOPGGSA-N |
| XLogP | 2.11 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |