C22H31N3O5S2 — CID 24981802
7a-methyl-5-oxo-N-(5-piperidin-1-ylsulfonyl-2-propan-2-yloxyphenyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 24981802) has the molecular formula C22H31N3O5S2 and a molecular weight of 481.64 g/mol. Its IUPAC name is 7a-methyl-5-oxo-N-(5-piperidin-1-ylsulfonyl-2-propan-2-yloxyphenyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | 7a-methyl-5-oxo-N-(5-piperidin-1-ylsulfonyl-2-propan-2-yloxyphenyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 24981802 |
| Molecular Formula | C22H31N3O5S2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 7a-methyl-5-oxo-N-(5-piperidin-1-ylsulfonyl-2-propan-2-yloxyphenyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)C1CSC2(C)CCC(=O)N12 |
| InChI | InChI=1S/C22H31N3O5S2/c1-15(2)30-19-8-7-16(32(28,29)24-11-5-4-6-12-24)13-17(19)23-21(27)18-14-31-22(3)10-9-20(26)25(18)22/h7-8,13,15,18H,4-6,9-12,14H2,1-3H3,(H,23,27) |
| InChIKey | FBZFBPKGIFSYST-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |