C19H25N3O4S2 — CID 8883487
(3S,7aR)-7a-methyl-5-oxo-N-(3-piperidin-1-ylsulfonylphenyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 8883487) has the molecular formula C19H25N3O4S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is (3S,7aR)-7a-methyl-5-oxo-N-(3-piperidin-1-ylsulfonylphenyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3S,7aR)-7a-methyl-5-oxo-N-(3-piperidin-1-ylsulfonylphenyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 8883487 |
| Molecular Formula | C19H25N3O4S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | (3S,7aR)-7a-methyl-5-oxo-N-(3-piperidin-1-ylsulfonylphenyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | C[C@@]12CCC(=O)N1[C@@H](C(=O)Nc1cccc(S(=O)(=O)N3CCCCC3)c1)CS2 |
| InChI | InChI=1S/C19H25N3O4S2/c1-19-9-8-17(23)22(19)16(13-27-19)18(24)20-14-6-5-7-15(12-14)28(25,26)21-10-3-2-4-11-21/h5-7,12,16H,2-4,8-11,13H2,1H3,(H,20,24)/t16-,19-/m1/s1 |
| InChIKey | ZEEUOZDNIHTQQB-VQIMIIECSA-N |
| XLogP | 2.25 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |