C20H25N3O6S2 — CID 42908179
3-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazine-1-carbonyl]-7a-methyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one (PubChem CID 42908179) has the molecular formula C20H25N3O6S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is 3-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazine-1-carbonyl]-7a-methyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one.
| Compound Name | 3-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazine-1-carbonyl]-7a-methyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one |
|---|---|
| PubChem CID | 42908179 |
| Molecular Formula | C20H25N3O6S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 3-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazine-1-carbonyl]-7a-methyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one |
| SMILES | CC12CCC(=O)N1C(C(=O)N1CCN(S(=O)(=O)c3ccc4c(c3)OCCO4)CC1)CS2 |
| InChI | InChI=1S/C20H25N3O6S2/c1-20-5-4-18(24)23(20)15(13-30-20)19(25)21-6-8-22(9-7-21)31(26,27)14-2-3-16-17(12-14)29-11-10-28-16/h2-3,12,15H,4-11,13H2,1H3 |
| InChIKey | VDTFJAYRILYTKP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |