C21H29N3O4S2 — CID 32642788
(3R,7aS)-7a-methyl-3-[4-(2,4,6-trimethylphenyl)sulfonylpiperazine-1-carbonyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one (PubChem CID 32642788) has the molecular formula C21H29N3O4S2 and a molecular weight of 451.61 g/mol. Its IUPAC name is (3R,7aS)-7a-methyl-3-[4-(2,4,6-trimethylphenyl)sulfonylpiperazine-1-carbonyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one.
| Compound Name | (3R,7aS)-7a-methyl-3-[4-(2,4,6-trimethylphenyl)sulfonylpiperazine-1-carbonyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one |
|---|---|
| PubChem CID | 32642788 |
| Molecular Formula | C21H29N3O4S2 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | (3R,7aS)-7a-methyl-3-[4-(2,4,6-trimethylphenyl)sulfonylpiperazine-1-carbonyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCN(C(=O)[C@@H]3CS[C@@]4(C)CCC(=O)N34)CC2)c(C)c1 |
| InChI | InChI=1S/C21H29N3O4S2/c1-14-11-15(2)19(16(3)12-14)30(27,28)23-9-7-22(8-10-23)20(26)17-13-29-21(4)6-5-18(25)24(17)21/h11-12,17H,5-10,13H2,1-4H3/t17-,21-/m0/s1 |
| InChIKey | AEUWJBGJTWTAGZ-UWJYYQICSA-N |
| XLogP | 1.90 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |