C18H21F2N3O4S2 — CID 30825500
(3R,7aR)-3-[4-(3,4-difluorophenyl)sulfonylpiperazine-1-carbonyl]-7a-methyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one (PubChem CID 30825500) has the molecular formula C18H21F2N3O4S2 and a molecular weight of 445.51 g/mol. Its IUPAC name is (3R,7aR)-3-[4-(3,4-difluorophenyl)sulfonylpiperazine-1-carbonyl]-7a-methyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one.
| Compound Name | (3R,7aR)-3-[4-(3,4-difluorophenyl)sulfonylpiperazine-1-carbonyl]-7a-methyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one |
|---|---|
| PubChem CID | 30825500 |
| Molecular Formula | C18H21F2N3O4S2 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | (3R,7aR)-3-[4-(3,4-difluorophenyl)sulfonylpiperazine-1-carbonyl]-7a-methyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one |
| SMILES | C[C@@]12CCC(=O)N1[C@H](C(=O)N1CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC1)CS2 |
| InChI | InChI=1S/C18H21F2N3O4S2/c1-18-5-4-16(24)23(18)15(11-28-18)17(25)21-6-8-22(9-7-21)29(26,27)12-2-3-13(19)14(20)10-12/h2-3,10,15H,4-9,11H2,1H3/t15-,18+/m0/s1 |
| InChIKey | NKJMDGHRLHAUDV-MAUKXSAKSA-N |
| XLogP | 1.25 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |