C21H21FN2O3S — CID 42955007
N-[3-[(4-fluorophenyl)methoxy]phenyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 42955007) has the molecular formula C21H21FN2O3S and a molecular weight of 400.48 g/mol. Its IUPAC name is N-[3-[(4-fluorophenyl)methoxy]phenyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | N-[3-[(4-fluorophenyl)methoxy]phenyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 42955007 |
| Molecular Formula | C21H21FN2O3S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-[3-[(4-fluorophenyl)methoxy]phenyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | CC12CCC(=O)N1C(C(=O)Nc1cccc(OCc3ccc(F)cc3)c1)CS2 |
| InChI | InChI=1S/C21H21FN2O3S/c1-21-10-9-19(25)24(21)18(13-28-21)20(26)23-16-3-2-4-17(11-16)27-12-14-5-7-15(22)8-6-14/h2-8,11,18H,9-10,12-13H2,1H3,(H,23,26) |
| InChIKey | XLHVPMBIIIHPGQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |