C14H15FN2O2S — CID 40986865
(3R,7aR)-N-(3-fluorophenyl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 40986865) has the molecular formula C14H15FN2O2S and a molecular weight of 294.35 g/mol. Its IUPAC name is (3R,7aR)-N-(3-fluorophenyl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3R,7aR)-N-(3-fluorophenyl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 40986865 |
| Molecular Formula | C14H15FN2O2S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (3R,7aR)-N-(3-fluorophenyl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | C[C@@]12CCC(=O)N1[C@H](C(=O)Nc1cccc(F)c1)CS2 |
| InChI | InChI=1S/C14H15FN2O2S/c1-14-6-5-12(18)17(14)11(8-20-14)13(19)16-10-4-2-3-9(15)7-10/h2-4,7,11H,5-6,8H2,1H3,(H,16,19)/t11-,14+/m0/s1 |
| InChIKey | CELMKKFSNGYGTN-SMDDNHRTSA-N |
| XLogP | 2.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |