C15H18N2O3S2 — CID 95982055
(3R,7aS)-7a-methyl-N-[4-[(S)-methylsulfinyl]phenyl]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 95982055) has the molecular formula C15H18N2O3S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is (3R,7aS)-7a-methyl-N-[4-[(S)-methylsulfinyl]phenyl]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3R,7aS)-7a-methyl-N-[4-[(S)-methylsulfinyl]phenyl]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 95982055 |
| Molecular Formula | C15H18N2O3S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | (3R,7aS)-7a-methyl-N-[4-[(S)-methylsulfinyl]phenyl]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | C[S@](=O)c1ccc(NC(=O)[C@@H]2CS[C@@]3(C)CCC(=O)N23)cc1 |
| InChI | InChI=1S/C15H18N2O3S2/c1-15-8-7-13(18)17(15)12(9-21-15)14(19)16-10-3-5-11(6-4-10)22(2)20/h3-6,12H,7-9H2,1-2H3,(H,16,19)/t12-,15-,22-/m0/s1 |
| InChIKey | MHNWEFJAYRWOPN-LAKHIVPPSA-N |
| XLogP | 1.82 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |