C19H27N3O4S — CID 31297742
1-acetyl-N-(3-piperidin-1-ylsulfonylphenyl)piperidine-4-carboxamide (PubChem CID 31297742) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is 1-acetyl-N-(3-piperidin-1-ylsulfonylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-(3-piperidin-1-ylsulfonylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 31297742 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 1-acetyl-N-(3-piperidin-1-ylsulfonylphenyl)piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)Nc2cccc(S(=O)(=O)N3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C19H27N3O4S/c1-15(23)21-12-8-16(9-13-21)19(24)20-17-6-5-7-18(14-17)27(25,26)22-10-3-2-4-11-22/h5-7,14,16H,2-4,8-13H2,1H3,(H,20,24) |
| InChIKey | XROQHJZYWIGRNM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |