C20H27N3O4S — CID 55374582
N-[3-(azepan-1-ylsulfonyl)phenyl]-1-cyclopropyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 55374582) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is N-[3-(azepan-1-ylsulfonyl)phenyl]-1-cyclopropyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[3-(azepan-1-ylsulfonyl)phenyl]-1-cyclopropyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55374582 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-[3-(azepan-1-ylsulfonyl)phenyl]-1-cyclopropyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)N2CCCCCC2)c1)C1CC(=O)N(C2CC2)C1 |
| InChI | InChI=1S/C20H27N3O4S/c24-19-12-15(14-23(19)17-8-9-17)20(25)21-16-6-5-7-18(13-16)28(26,27)22-10-3-1-2-4-11-22/h5-7,13,15,17H,1-4,8-12,14H2,(H,21,25) |
| InChIKey | LHPAXCAUIRNTLE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |