C24H29N3O5S — CID 41094134
(3R)-1-(2-ethoxyphenyl)-5-oxo-N-(3-piperidin-1-ylsulfonylphenyl)pyrrolidine-3-carboxamide (PubChem CID 41094134) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is (3R)-1-(2-ethoxyphenyl)-5-oxo-N-(3-piperidin-1-ylsulfonylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(2-ethoxyphenyl)-5-oxo-N-(3-piperidin-1-ylsulfonylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 41094134 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | (3R)-1-(2-ethoxyphenyl)-5-oxo-N-(3-piperidin-1-ylsulfonylphenyl)pyrrolidine-3-carboxamide |
| SMILES | CCOc1ccccc1N1C[C@H](C(=O)Nc2cccc(S(=O)(=O)N3CCCCC3)c2)CC1=O |
| InChI | InChI=1S/C24H29N3O5S/c1-2-32-22-12-5-4-11-21(22)27-17-18(15-23(27)28)24(29)25-19-9-8-10-20(16-19)33(30,31)26-13-6-3-7-14-26/h4-5,8-12,16,18H,2-3,6-7,13-15,17H2,1H3,(H,25,29)/t18-/m1/s1 |
| InChIKey | QZTUNIFZYFFHFZ-GOSISDBHSA-N |
| XLogP | 3.25 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |