C24H28N4O5S — CID 55881506
1-(2-ethoxyphenyl)-N-[3-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 55881506) has the molecular formula C24H28N4O5S and a molecular weight of 484.58 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-N-[3-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2-ethoxyphenyl)-N-[3-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55881506 |
| Molecular Formula | C24H28N4O5S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 1-(2-ethoxyphenyl)-N-[3-[(Z)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCOc1ccccc1N1CC(C(=O)Nc2cccc(S(=O)(=O)/N=C3/CCCN3C)c2)CC1=O |
| InChI | InChI=1S/C24H28N4O5S/c1-3-33-21-11-5-4-10-20(21)28-16-17(14-23(28)29)24(30)25-18-8-6-9-19(15-18)34(31,32)26-22-12-7-13-27(22)2/h4-6,8-11,15,17H,3,7,12-14,16H2,1-2H3,(H,25,30)/b26-22- |
| InChIKey | RTCWPYUSDCFUNR-ROMGYVFFSA-N |
| XLogP | 2.89 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|