C20H25N3O3 — CID 46568551
1-cyclopentyl-N-[3-(cyclopropanecarbonylamino)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 46568551) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 1-cyclopentyl-N-[3-(cyclopropanecarbonylamino)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-cyclopentyl-N-[3-(cyclopropanecarbonylamino)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46568551 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 1-cyclopentyl-N-[3-(cyclopropanecarbonylamino)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)C2CC(=O)N(C3CCCC3)C2)c1)C1CC1 |
| InChI | InChI=1S/C20H25N3O3/c24-18-10-14(12-23(18)17-6-1-2-7-17)20(26)22-16-5-3-4-15(11-16)21-19(25)13-8-9-13/h3-5,11,13-14,17H,1-2,6-10,12H2,(H,21,25)(H,22,26) |
| InChIKey | LDMGVZGCRKETOE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |