C19H23F3N2O2 — CID 113185547
1-cycloheptyl-5-oxo-N-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 113185547) has the molecular formula C19H23F3N2O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is 1-cycloheptyl-5-oxo-N-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-cycloheptyl-5-oxo-N-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113185547 |
| Molecular Formula | C19H23F3N2O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 1-cycloheptyl-5-oxo-N-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)C1CC(=O)N(C2CCCCCC2)C1 |
| InChI | InChI=1S/C19H23F3N2O2/c20-19(21,22)14-6-5-7-15(11-14)23-18(26)13-10-17(25)24(12-13)16-8-3-1-2-4-9-16/h5-7,11,13,16H,1-4,8-10,12H2,(H,23,26) |
| InChIKey | SVLTWUIASBSIHK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |