C19H24F3N3O2 — CID 99805339
(3R)-1-cycloheptyl-5-oxo-N'-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carbohydrazide (PubChem CID 99805339) has the molecular formula C19H24F3N3O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is (3R)-1-cycloheptyl-5-oxo-N'-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carbohydrazide.
| Compound Name | (3R)-1-cycloheptyl-5-oxo-N'-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 99805339 |
| Molecular Formula | C19H24F3N3O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (3R)-1-cycloheptyl-5-oxo-N'-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carbohydrazide |
| SMILES | O=C(NNc1cccc(C(F)(F)F)c1)[C@@H]1CC(=O)N(C2CCCCCC2)C1 |
| InChI | InChI=1S/C19H24F3N3O2/c20-19(21,22)14-6-5-7-15(11-14)23-24-18(27)13-10-17(26)25(12-13)16-8-3-1-2-4-9-16/h5-7,11,13,16,23H,1-4,8-10,12H2,(H,24,27)/t13-/m1/s1 |
| InChIKey | DDMZIKSVNOOMQE-CYBMUJFWSA-N |
| XLogP | 3.72 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|