C17H22N2O2 — CID 2266114
(3S)-1-cyclohexyl-5-oxo-N-phenylpyrrolidine-3-carboxamide (PubChem CID 2266114) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is (3S)-1-cyclohexyl-5-oxo-N-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-cyclohexyl-5-oxo-N-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 2266114 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (3S)-1-cyclohexyl-5-oxo-N-phenylpyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)[C@H]1CC(=O)N(C2CCCCC2)C1 |
| InChI | InChI=1S/C17H22N2O2/c20-16-11-13(12-19(16)15-9-5-2-6-10-15)17(21)18-14-7-3-1-4-8-14/h1,3-4,7-8,13,15H,2,5-6,9-12H2,(H,18,21)/t13-/m0/s1 |
| InChIKey | BVUSHGJZBZMDML-ZDUSSCGKSA-N |
| XLogP | 2.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |