C20H20F3N3O2 — CID 95247840
(3R)-5-oxo-1-(2-phenylethyl)-N'-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carbohydrazide (PubChem CID 95247840) has the molecular formula C20H20F3N3O2 and a molecular weight of 391.39 g/mol. Its IUPAC name is (3R)-5-oxo-1-(2-phenylethyl)-N'-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carbohydrazide.
| Compound Name | (3R)-5-oxo-1-(2-phenylethyl)-N'-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 95247840 |
| Molecular Formula | C20H20F3N3O2 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (3R)-5-oxo-1-(2-phenylethyl)-N'-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carbohydrazide |
| SMILES | O=C(NNc1cccc(C(F)(F)F)c1)[C@@H]1CC(=O)N(CCc2ccccc2)C1 |
| InChI | InChI=1S/C20H20F3N3O2/c21-20(22,23)16-7-4-8-17(12-16)24-25-19(28)15-11-18(27)26(13-15)10-9-14-5-2-1-3-6-14/h1-8,12,15,24H,9-11,13H2,(H,25,28)/t15-/m1/s1 |
| InChIKey | GLQDLSHSYQBSAB-OAHLLOKOSA-N |
| XLogP | 3.24 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|