C19H24N2O4S — CID 55612889
N-(3-cyclopentylsulfonylphenyl)-1-cyclopropyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 55612889) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-(3-cyclopentylsulfonylphenyl)-1-cyclopropyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(3-cyclopentylsulfonylphenyl)-1-cyclopropyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55612889 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-(3-cyclopentylsulfonylphenyl)-1-cyclopropyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)C2CCCC2)c1)C1CC(=O)N(C2CC2)C1 |
| InChI | InChI=1S/C19H24N2O4S/c22-18-10-13(12-21(18)15-8-9-15)19(23)20-14-4-3-7-17(11-14)26(24,25)16-5-1-2-6-16/h3-4,7,11,13,15-16H,1-2,5-6,8-10,12H2,(H,20,23) |
| InChIKey | RUSZPQYLUPIHBC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |