C17H25N3O3S — CID 110314101
1-cyclohexyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)urea (PubChem CID 110314101) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is 1-cyclohexyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)urea.
| Compound Name | 1-cyclohexyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)urea |
|---|---|
| PubChem CID | 110314101 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-cyclohexyl-3-(3-pyrrolidin-1-ylsulfonylphenyl)urea |
| SMILES | O=C(Nc1cccc(S(=O)(=O)N2CCCC2)c1)NC1CCCCC1 |
| InChI | InChI=1S/C17H25N3O3S/c21-17(18-14-7-2-1-3-8-14)19-15-9-6-10-16(13-15)24(22,23)20-11-4-5-12-20/h6,9-10,13-14H,1-5,7-8,11-12H2,(H2,18,19,21) |
| InChIKey | ASAKKBNYGFHLLA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |