C21H24N2O5S — CID 8714129
1-(3-acetylphenyl)sulfonyl-N-(3-methoxyphenyl)piperidine-4-carboxamide (PubChem CID 8714129) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is 1-(3-acetylphenyl)sulfonyl-N-(3-methoxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(3-acetylphenyl)sulfonyl-N-(3-methoxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 8714129 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 1-(3-acetylphenyl)sulfonyl-N-(3-methoxyphenyl)piperidine-4-carboxamide |
| SMILES | COc1cccc(NC(=O)C2CCN(S(=O)(=O)c3cccc(C(C)=O)c3)CC2)c1 |
| InChI | InChI=1S/C21H24N2O5S/c1-15(24)17-5-3-8-20(13-17)29(26,27)23-11-9-16(10-12-23)21(25)22-18-6-4-7-19(14-18)28-2/h3-8,13-14,16H,9-12H2,1-2H3,(H,22,25) |
| InChIKey | OXUQLTRPMRFGJO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |