C20H21BrN2O4S — CID 1327585
N-(3-acetylphenyl)-1-(4-bromophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 1327585) has the molecular formula C20H21BrN2O4S and a molecular weight of 465.37 g/mol. Its IUPAC name is N-(3-acetylphenyl)-1-(4-bromophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3-acetylphenyl)-1-(4-bromophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 1327585 |
| Molecular Formula | C20H21BrN2O4S |
| Molecular Weight | 465.37 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | N-(3-acetylphenyl)-1-(4-bromophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)C2CCN(S(=O)(=O)c3ccc(Br)cc3)CC2)c1 |
| InChI | InChI=1S/C20H21BrN2O4S/c1-14(24)16-3-2-4-18(13-16)22-20(25)15-9-11-23(12-10-15)28(26,27)19-7-5-17(21)6-8-19/h2-8,13,15H,9-12H2,1H3,(H,22,25) |
| InChIKey | SPTWNHRRSCKRAY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |