C20H23BrN2O3S — CID 1327310
1-(4-bromophenyl)sulfonyl-N-(3,5-dimethylphenyl)piperidine-4-carboxamide (PubChem CID 1327310) has the molecular formula C20H23BrN2O3S and a molecular weight of 451.39 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-N-(3,5-dimethylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-bromophenyl)sulfonyl-N-(3,5-dimethylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 1327310 |
| Molecular Formula | C20H23BrN2O3S |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-N-(3,5-dimethylphenyl)piperidine-4-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)C2CCN(S(=O)(=O)c3ccc(Br)cc3)CC2)c1 |
| InChI | InChI=1S/C20H23BrN2O3S/c1-14-11-15(2)13-18(12-14)22-20(24)16-7-9-23(10-8-16)27(25,26)19-5-3-17(21)4-6-19/h3-6,11-13,16H,7-10H2,1-2H3,(H,22,24) |
| InChIKey | XSFQDTANACCONT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |