C23H29BrN2O3S — CID 100795683
N-(4-bromo-2,6-diethylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 100795683) has the molecular formula C23H29BrN2O3S and a molecular weight of 493.47 g/mol. Its IUPAC name is N-(4-bromo-2,6-diethylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(4-bromo-2,6-diethylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 100795683 |
| Molecular Formula | C23H29BrN2O3S |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | N-(4-bromo-2,6-diethylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CCc1cc(Br)cc(CC)c1NC(=O)C1CCN(S(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C23H29BrN2O3S/c1-4-17-14-20(24)15-18(5-2)22(17)25-23(27)19-10-12-26(13-11-19)30(28,29)21-8-6-16(3)7-9-21/h6-9,14-15,19H,4-5,10-13H2,1-3H3,(H,25,27) |
| InChIKey | CVVQCSCKHVHJMM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |