C22H26BrFN2O3S — CID 100795631
N-(4-bromo-2,6-diethylphenyl)-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 100795631) has the molecular formula C22H26BrFN2O3S and a molecular weight of 497.43 g/mol. Its IUPAC name is N-(4-bromo-2,6-diethylphenyl)-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(4-bromo-2,6-diethylphenyl)-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 100795631 |
| Molecular Formula | C22H26BrFN2O3S |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | N-(4-bromo-2,6-diethylphenyl)-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CCc1cc(Br)cc(CC)c1NC(=O)C1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H26BrFN2O3S/c1-3-15-13-18(23)14-16(4-2)21(15)25-22(27)17-9-11-26(12-10-17)30(28,29)20-7-5-19(24)6-8-20/h5-8,13-14,17H,3-4,9-12H2,1-2H3,(H,25,27) |
| InChIKey | RMUFXRPFGFSMMV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |