C25H27BrN2O3S — CID 100795824
N-(4-bromo-2-ethyl-6-methylphenyl)-1-naphthalen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 100795824) has the molecular formula C25H27BrN2O3S and a molecular weight of 515.47 g/mol. Its IUPAC name is N-(4-bromo-2-ethyl-6-methylphenyl)-1-naphthalen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(4-bromo-2-ethyl-6-methylphenyl)-1-naphthalen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 100795824 |
| Molecular Formula | C25H27BrN2O3S |
| Molecular Weight | 515.47 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | N-(4-bromo-2-ethyl-6-methylphenyl)-1-naphthalen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | CCc1cc(Br)cc(C)c1NC(=O)C1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C25H27BrN2O3S/c1-3-18-15-22(26)14-17(2)24(18)27-25(29)20-10-12-28(13-11-20)32(30,31)23-9-8-19-6-4-5-7-21(19)16-23/h4-9,14-16,20H,3,10-13H2,1-2H3,(H,27,29) |
| InChIKey | AVMGANHAWSNDHD-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |