C19H20Cl2N2O3S — CID 24638766
N-(3,4-dichlorophenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 24638766) has the molecular formula C19H20Cl2N2O3S and a molecular weight of 427.35 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 24638766 |
| Molecular Formula | C19H20Cl2N2O3S |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | N-(3,4-dichlorophenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)Nc3ccc(Cl)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C19H20Cl2N2O3S/c1-13-2-5-16(6-3-13)27(25,26)23-10-8-14(9-11-23)19(24)22-15-4-7-17(20)18(21)12-15/h2-7,12,14H,8-11H2,1H3,(H,22,24) |
| InChIKey | KFADORPBNWLSQO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |